C14H25NO5 — CID 122652546
tert-butyl 4-hydroxypiperidine-1-carboxylate;2-methylprop-2-enoic acid (PubChem CID 122652546) has the molecular formula C14H25NO5 and a molecular weight of 287.36 g/mol. Its IUPAC name is tert-butyl 4-hydroxypiperidine-1-carboxylate;2-methylprop-2-enoic acid.
| Compound Name | tert-butyl 4-hydroxypiperidine-1-carboxylate;2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 122652546 |
| Molecular Formula | C14H25NO5 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | tert-butyl 4-hydroxypiperidine-1-carboxylate;2-methylprop-2-enoic acid |
| SMILES | C=C(C)C(=O)O.CC(C)(C)OC(=O)N1CCC(O)CC1 |
| InChI | InChI=1S/C10H19NO3.C4H6O2/c1-10(2,3)14-9(13)11-6-4-8(12)5-7-11;1-3(2)4(5)6/h8,12H,4-7H2,1-3H3;1H2,2H3,(H,5,6) |
| InChIKey | MJOCRJQUZIZLEE-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|