C10H16Cl3NO3 — CID 163212680
(1,1,1-trichloro-2-methylpropan-2-yl) 4-hydroxypiperidine-1-carboxylate (PubChem CID 163212680) has the molecular formula C10H16Cl3NO3 and a molecular weight of 304.60 g/mol. Its IUPAC name is (1,1,1-trichloro-2-methylpropan-2-yl) 4-hydroxypiperidine-1-carboxylate.
| Compound Name | (1,1,1-trichloro-2-methylpropan-2-yl) 4-hydroxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 163212680 |
| Molecular Formula | C10H16Cl3NO3 |
| Molecular Weight | 304.60 g/mol |
| Exact Mass | 303.02 |
| IUPAC Name | (1,1,1-trichloro-2-methylpropan-2-yl) 4-hydroxypiperidine-1-carboxylate |
| SMILES | CC(C)(OC(=O)N1CCC(O)CC1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C10H16Cl3NO3/c1-9(2,10(11,12)13)17-8(16)14-5-3-7(15)4-6-14/h7,15H,3-6H2,1-2H3 |
| InChIKey | ADZPNYQKMXIDMV-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.60 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|