C14H27NO4 — CID 157216636
tert-butyl 3-hydroxypyrrolidine-1-carboxylate;cyclopentanol (PubChem CID 157216636) has the molecular formula C14H27NO4 and a molecular weight of 273.37 g/mol. Its IUPAC name is tert-butyl 3-hydroxypyrrolidine-1-carboxylate;cyclopentanol.
| Compound Name | tert-butyl 3-hydroxypyrrolidine-1-carboxylate;cyclopentanol |
|---|---|
| PubChem CID | 157216636 |
| Molecular Formula | C14H27NO4 |
| Molecular Weight | 273.37 g/mol |
| Exact Mass | 273.19 |
| IUPAC Name | tert-butyl 3-hydroxypyrrolidine-1-carboxylate;cyclopentanol |
| SMILES | CC(C)(C)OC(=O)N1CCC(O)C1.OC1CCCC1 |
| InChI | InChI=1S/C9H17NO3.C5H10O/c1-9(2,3)13-8(12)10-5-4-7(11)6-10;6-5-3-1-2-4-5/h7,11H,4-6H2,1-3H3;5-6H,1-4H2 |
| InChIKey | ASMOEZDXRWRSGP-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.37 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |