C18H29NO3 — CID 156749659
tert-butyl 3-hydroxyazepane-1-carboxylate;toluene (PubChem CID 156749659) has the molecular formula C18H29NO3 and a molecular weight of 307.43 g/mol. Its IUPAC name is tert-butyl 3-hydroxyazepane-1-carboxylate;toluene.
| Compound Name | tert-butyl 3-hydroxyazepane-1-carboxylate;toluene |
|---|---|
| PubChem CID | 156749659 |
| Molecular Formula | C18H29NO3 |
| Molecular Weight | 307.43 g/mol |
| Exact Mass | 307.21 |
| IUPAC Name | tert-butyl 3-hydroxyazepane-1-carboxylate;toluene |
| SMILES | CC(C)(C)OC(=O)N1CCCCC(O)C1.Cc1ccccc1 |
| InChI | InChI=1S/C11H21NO3.C7H8/c1-11(2,3)15-10(14)12-7-5-4-6-9(13)8-12;1-7-5-3-2-4-6-7/h9,13H,4-8H2,1-3H3;2-6H,1H3 |
| InChIKey | HJQTVLIWLMTXDN-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.43 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |