C22H27NO2 — CID 101207420
tert-butyl (3R,4S)-3,4-diphenylpiperidine-1-carboxylate (PubChem CID 101207420) has the molecular formula C22H27NO2 and a molecular weight of 337.46 g/mol. Its IUPAC name is tert-butyl (3R,4S)-3,4-diphenylpiperidine-1-carboxylate.
| Compound Name | tert-butyl (3R,4S)-3,4-diphenylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 101207420 |
| Molecular Formula | C22H27NO2 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | tert-butyl (3R,4S)-3,4-diphenylpiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H](c2ccccc2)[C@H](c2ccccc2)C1 |
| InChI | InChI=1S/C22H27NO2/c1-22(2,3)25-21(24)23-15-14-19(17-10-6-4-7-11-17)20(16-23)18-12-8-5-9-13-18/h4-13,19-20H,14-16H2,1-3H3/t19-,20+/m1/s1 |
| InChIKey | ZHYRUWSUTYTASR-UXHICEINSA-N |
| XLogP | 5.19 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |