C29H33NO4S — CID 67000291
tert-butyl 3-[3-(3-methylsulfonylphenyl)phenyl]-4-phenylpiperidine-1-carboxylate (PubChem CID 67000291) has the molecular formula C29H33NO4S and a molecular weight of 491.65 g/mol. Its IUPAC name is tert-butyl 3-[3-(3-methylsulfonylphenyl)phenyl]-4-phenylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[3-(3-methylsulfonylphenyl)phenyl]-4-phenylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 67000291 |
| Molecular Formula | C29H33NO4S |
| Molecular Weight | 491.65 g/mol |
| Exact Mass | 491.21 |
| IUPAC Name | tert-butyl 3-[3-(3-methylsulfonylphenyl)phenyl]-4-phenylpiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2ccccc2)C(c2cccc(-c3cccc(S(C)(=O)=O)c3)c2)C1 |
| InChI | InChI=1S/C29H33NO4S/c1-29(2,3)34-28(31)30-17-16-26(21-10-6-5-7-11-21)27(20-30)24-14-8-12-22(18-24)23-13-9-15-25(19-23)35(4,32)33/h5-15,18-19,26-27H,16-17,20H2,1-4H3 |
| InChIKey | UOONRKNFZYVFQQ-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.65 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |