C22H27NO2 — CID 155788326
tert-butyl 3-(3-phenylphenyl)piperidine-1-carboxylate (PubChem CID 155788326) has the molecular formula C22H27NO2 and a molecular weight of 337.46 g/mol. Its IUPAC name is tert-butyl 3-(3-phenylphenyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-(3-phenylphenyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 155788326 |
| Molecular Formula | C22H27NO2 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | tert-butyl 3-(3-phenylphenyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(c2cccc(-c3ccccc3)c2)C1 |
| InChI | InChI=1S/C22H27NO2/c1-22(2,3)25-21(24)23-14-8-13-20(16-23)19-12-7-11-18(15-19)17-9-5-4-6-10-17/h4-7,9-12,15,20H,8,13-14,16H2,1-3H3 |
| InChIKey | ZKVJJJUBZMOYNM-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |