C16H24N2O2 — CID 135135280
tert-butyl 3-(2-methyl-4-pyridinyl)piperidine-1-carboxylate (PubChem CID 135135280) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is tert-butyl 3-(2-methyl-4-pyridinyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-(2-methyl-4-pyridinyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 135135280 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | tert-butyl 3-(2-methyl-4-pyridinyl)piperidine-1-carboxylate |
| SMILES | Cc1cc(C2CCCN(C(=O)OC(C)(C)C)C2)ccn1 |
| InChI | InChI=1S/C16H24N2O2/c1-12-10-13(7-8-17-12)14-6-5-9-18(11-14)15(19)20-16(2,3)4/h7-8,10,14H,5-6,9,11H2,1-4H3 |
| InChIKey | TYBMBLXBSLGUNQ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |