C16H24N2O3 — CID 163238292
tert-butyl 3-(6-methoxy-3-pyridinyl)piperidine-1-carboxylate (PubChem CID 163238292) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is tert-butyl 3-(6-methoxy-3-pyridinyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-(6-methoxy-3-pyridinyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 163238292 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | tert-butyl 3-(6-methoxy-3-pyridinyl)piperidine-1-carboxylate |
| SMILES | COc1ccc(C2CCCN(C(=O)OC(C)(C)C)C2)cn1 |
| InChI | InChI=1S/C16H24N2O3/c1-16(2,3)21-15(19)18-9-5-6-13(11-18)12-7-8-14(20-4)17-10-12/h7-8,10,13H,5-6,9,11H2,1-4H3 |
| InChIKey | MQFKXNNVBZKNJH-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |