C16H26N2O3S — CID 161346804
tert-butyl (3S)-3-[(6-methoxy-3-pyridinyl)methyl]pyrrolidine-1-carboxylate;sulfane (PubChem CID 161346804) has the molecular formula C16H26N2O3S and a molecular weight of 326.46 g/mol. Its IUPAC name is tert-butyl (3S)-3-[(6-methoxy-3-pyridinyl)methyl]pyrrolidine-1-carboxylate;sulfane.
| Compound Name | tert-butyl (3S)-3-[(6-methoxy-3-pyridinyl)methyl]pyrrolidine-1-carboxylate;sulfane |
|---|---|
| PubChem CID | 161346804 |
| Molecular Formula | C16H26N2O3S |
| Molecular Weight | 326.46 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | tert-butyl (3S)-3-[(6-methoxy-3-pyridinyl)methyl]pyrrolidine-1-carboxylate;sulfane |
| SMILES | COc1ccc(C[C@H]2CCN(C(=O)OC(C)(C)C)C2)cn1.S |
| InChI | InChI=1S/C16H24N2O3.H2S/c1-16(2,3)21-15(19)18-8-7-13(11-18)9-12-5-6-14(20-4)17-10-12;/h5-6,10,13H,7-9,11H2,1-4H3;1H2/t13-;/m1./s1 |
| InChIKey | VNKGUFNGZSIPMG-BTQNPOSSSA-N |
| XLogP | 3.00 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.46 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |