C17H25NO4S — CID 154721638
tert-butyl 4-(3-methylsulfonylphenyl)piperidine-1-carboxylate (PubChem CID 154721638) has the molecular formula C17H25NO4S and a molecular weight of 339.46 g/mol. Its IUPAC name is tert-butyl 4-(3-methylsulfonylphenyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(3-methylsulfonylphenyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 154721638 |
| Molecular Formula | C17H25NO4S |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | tert-butyl 4-(3-methylsulfonylphenyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2cccc(S(C)(=O)=O)c2)CC1 |
| InChI | InChI=1S/C17H25NO4S/c1-17(2,3)22-16(19)18-10-8-13(9-11-18)14-6-5-7-15(12-14)23(4,20)21/h5-7,12-13H,8-11H2,1-4H3 |
| InChIKey | GXNOUVWQPMXHNT-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |