C17H26N2O3S — CID 166047373
tert-butyl 4-[(methyl-oxo-phenyl-λ6-sulfanylidene)amino]piperidine-1-carboxylate (PubChem CID 166047373) has the molecular formula C17H26N2O3S and a molecular weight of 338.47 g/mol. Its IUPAC name is tert-butyl 4-[(methyl-oxo-phenyl-λ6-sulfanylidene)amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(methyl-oxo-phenyl-λ6-sulfanylidene)amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 166047373 |
| Molecular Formula | C17H26N2O3S |
| Molecular Weight | 338.47 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | tert-butyl 4-[(methyl-oxo-phenyl-λ6-sulfanylidene)amino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(N=[S@@](C)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C17H26N2O3S/c1-17(2,3)22-16(20)19-12-10-14(11-13-19)18-23(4,21)15-8-6-5-7-9-15/h5-9,14H,10-13H2,1-4H3/t23-/m0/s1 |
| InChIKey | NXSAQFZXPHKWDT-QHCPKHFHSA-N |
| XLogP | 3.54 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.47 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |