C23H29NO2 — CID 174192656
tert-butyl 3-(1,1-diphenylethyl)pyrrolidine-1-carboxylate (PubChem CID 174192656) has the molecular formula C23H29NO2 and a molecular weight of 351.49 g/mol. Its IUPAC name is tert-butyl 3-(1,1-diphenylethyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-(1,1-diphenylethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 174192656 |
| Molecular Formula | C23H29NO2 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | tert-butyl 3-(1,1-diphenylethyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(C)(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C23H29NO2/c1-22(2,3)26-21(25)24-16-15-20(17-24)23(4,18-11-7-5-8-12-18)19-13-9-6-10-14-19/h5-14,20H,15-17H2,1-4H3 |
| InChIKey | BWCDXHLNGGQJQJ-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |