C18H25NO3 — CID 107091890
tert-butyl 3-[2-(2-methylphenyl)acetyl]pyrrolidine-1-carboxylate (PubChem CID 107091890) has the molecular formula C18H25NO3 and a molecular weight of 303.40 g/mol. Its IUPAC name is tert-butyl 3-[2-(2-methylphenyl)acetyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[2-(2-methylphenyl)acetyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 107091890 |
| Molecular Formula | C18H25NO3 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | tert-butyl 3-[2-(2-methylphenyl)acetyl]pyrrolidine-1-carboxylate |
| SMILES | Cc1ccccc1CC(=O)C1CCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C18H25NO3/c1-13-7-5-6-8-14(13)11-16(20)15-9-10-19(12-15)17(21)22-18(2,3)4/h5-8,15H,9-12H2,1-4H3 |
| InChIKey | YESKIOUBOHSQME-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |