C17H21ClFNO3 — CID 107092124
tert-butyl 3-[2-(3-chloro-4-fluorophenyl)acetyl]pyrrolidine-1-carboxylate (PubChem CID 107092124) has the molecular formula C17H21ClFNO3 and a molecular weight of 341.81 g/mol. Its IUPAC name is tert-butyl 3-[2-(3-chloro-4-fluorophenyl)acetyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[2-(3-chloro-4-fluorophenyl)acetyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 107092124 |
| Molecular Formula | C17H21ClFNO3 |
| Molecular Weight | 341.81 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | tert-butyl 3-[2-(3-chloro-4-fluorophenyl)acetyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(=O)Cc2ccc(F)c(Cl)c2)C1 |
| InChI | InChI=1S/C17H21ClFNO3/c1-17(2,3)23-16(22)20-7-6-12(10-20)15(21)9-11-4-5-14(19)13(18)8-11/h4-5,8,12H,6-7,9-10H2,1-3H3 |
| InChIKey | IIVUYSBRQFXPFH-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.81 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |