C15H18ClF2NO2 — CID 169498666
tert-butyl 3-(5-chloro-2,4-difluorophenyl)pyrrolidine-1-carboxylate (PubChem CID 169498666) has the molecular formula C15H18ClF2NO2 and a molecular weight of 317.76 g/mol. Its IUPAC name is tert-butyl 3-(5-chloro-2,4-difluorophenyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-(5-chloro-2,4-difluorophenyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 169498666 |
| Molecular Formula | C15H18ClF2NO2 |
| Molecular Weight | 317.76 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | tert-butyl 3-(5-chloro-2,4-difluorophenyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2cc(Cl)c(F)cc2F)C1 |
| InChI | InChI=1S/C15H18ClF2NO2/c1-15(2,3)21-14(20)19-5-4-9(8-19)10-6-11(16)13(18)7-12(10)17/h6-7,9H,4-5,8H2,1-3H3 |
| InChIKey | TYAIEPRXQOHWMY-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.76 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|