C16H19ClF3NO2 — CID 169498216
tert-butyl 3-[2-chloro-4-(trifluoromethyl)phenyl]pyrrolidine-1-carboxylate (PubChem CID 169498216) has the molecular formula C16H19ClF3NO2 and a molecular weight of 349.78 g/mol. Its IUPAC name is tert-butyl 3-[2-chloro-4-(trifluoromethyl)phenyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[2-chloro-4-(trifluoromethyl)phenyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 169498216 |
| Molecular Formula | C16H19ClF3NO2 |
| Molecular Weight | 349.78 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | tert-butyl 3-[2-chloro-4-(trifluoromethyl)phenyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2ccc(C(F)(F)F)cc2Cl)C1 |
| InChI | InChI=1S/C16H19ClF3NO2/c1-15(2,3)23-14(22)21-7-6-10(9-21)12-5-4-11(8-13(12)17)16(18,19)20/h4-5,8,10H,6-7,9H2,1-3H3 |
| InChIKey | KIWWCTQZHPKEAR-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.78 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |