C18H26ClNO4S — CID 175975278
tert-butyl 3-(4-tert-butylsulfonyl-2-chlorophenyl)azetidine-1-carboxylate (PubChem CID 175975278) has the molecular formula C18H26ClNO4S and a molecular weight of 387.93 g/mol. Its IUPAC name is tert-butyl 3-(4-tert-butylsulfonyl-2-chlorophenyl)azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-(4-tert-butylsulfonyl-2-chlorophenyl)azetidine-1-carboxylate |
|---|---|
| PubChem CID | 175975278 |
| Molecular Formula | C18H26ClNO4S |
| Molecular Weight | 387.93 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | tert-butyl 3-(4-tert-butylsulfonyl-2-chlorophenyl)azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(c2ccc(S(=O)(=O)C(C)(C)C)cc2Cl)C1 |
| InChI | InChI=1S/C18H26ClNO4S/c1-17(2,3)24-16(21)20-10-12(11-20)14-8-7-13(9-15(14)19)25(22,23)18(4,5)6/h7-9,12H,10-11H2,1-6H3 |
| InChIKey | QNHRGPPBHMTZKW-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.93 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |