C22H26ClNO5S — CID 66877481
tert-butyl 3-[4-(3-chlorophenyl)sulfonyl-2-methoxyphenyl]pyrrolidine-1-carboxylate (PubChem CID 66877481) has the molecular formula C22H26ClNO5S and a molecular weight of 451.97 g/mol. Its IUPAC name is tert-butyl 3-[4-(3-chlorophenyl)sulfonyl-2-methoxyphenyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[4-(3-chlorophenyl)sulfonyl-2-methoxyphenyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 66877481 |
| Molecular Formula | C22H26ClNO5S |
| Molecular Weight | 451.97 g/mol |
| Exact Mass | 451.12 |
| IUPAC Name | tert-butyl 3-[4-(3-chlorophenyl)sulfonyl-2-methoxyphenyl]pyrrolidine-1-carboxylate |
| SMILES | COc1cc(S(=O)(=O)c2cccc(Cl)c2)ccc1C1CCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C22H26ClNO5S/c1-22(2,3)29-21(25)24-11-10-15(14-24)19-9-8-18(13-20(19)28-4)30(26,27)17-7-5-6-16(23)12-17/h5-9,12-13,15H,10-11,14H2,1-4H3 |
| InChIKey | XWVTVNOJTJESMI-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.97 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |