C16H22ClNO3 — CID 58222053
tert-butyl 4-(4-chloro-2-hydroxyphenyl)piperidine-1-carboxylate (PubChem CID 58222053) has the molecular formula C16H22ClNO3 and a molecular weight of 311.81 g/mol. Its IUPAC name is tert-butyl 4-(4-chloro-2-hydroxyphenyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(4-chloro-2-hydroxyphenyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 58222053 |
| Molecular Formula | C16H22ClNO3 |
| Molecular Weight | 311.81 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | tert-butyl 4-(4-chloro-2-hydroxyphenyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2ccc(Cl)cc2O)CC1 |
| InChI | InChI=1S/C16H22ClNO3/c1-16(2,3)21-15(20)18-8-6-11(7-9-18)13-5-4-12(17)10-14(13)19/h4-5,10-11,19H,6-9H2,1-3H3 |
| InChIKey | RJQQPEXGTJPVPJ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.81 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |