C21H32ClNO3 — CID 58222125
tert-butyl 4-[4-chloro-2-[2-(hydroxymethyl)butyl]phenyl]piperidine-1-carboxylate (PubChem CID 58222125) has the molecular formula C21H32ClNO3 and a molecular weight of 381.94 g/mol. Its IUPAC name is tert-butyl 4-[4-chloro-2-[2-(hydroxymethyl)butyl]phenyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-chloro-2-[2-(hydroxymethyl)butyl]phenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 58222125 |
| Molecular Formula | C21H32ClNO3 |
| Molecular Weight | 381.94 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | tert-butyl 4-[4-chloro-2-[2-(hydroxymethyl)butyl]phenyl]piperidine-1-carboxylate |
| SMILES | CCC(CO)Cc1cc(Cl)ccc1C1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C21H32ClNO3/c1-5-15(14-24)12-17-13-18(22)6-7-19(17)16-8-10-23(11-9-16)20(25)26-21(2,3)4/h6-7,13,15-16,24H,5,8-12,14H2,1-4H3 |
| InChIKey | GHCRUWKTGLGJKF-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.94 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |