C21H30FNO3 — CID 58221982
tert-butyl 4-[4-fluoro-2-(2-formylbutyl)phenyl]piperidine-1-carboxylate (PubChem CID 58221982) has the molecular formula C21H30FNO3 and a molecular weight of 363.47 g/mol. Its IUPAC name is tert-butyl 4-[4-fluoro-2-(2-formylbutyl)phenyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-fluoro-2-(2-formylbutyl)phenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 58221982 |
| Molecular Formula | C21H30FNO3 |
| Molecular Weight | 363.47 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | tert-butyl 4-[4-fluoro-2-(2-formylbutyl)phenyl]piperidine-1-carboxylate |
| SMILES | CCC(C=O)Cc1cc(F)ccc1C1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C21H30FNO3/c1-5-15(14-24)12-17-13-18(22)6-7-19(17)16-8-10-23(11-9-16)20(25)26-21(2,3)4/h6-7,13-16H,5,8-12H2,1-4H3 |
| InChIKey | JPIXEPRNCSPGRR-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.47 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|