C22H31FN2O3 — CID 58222063
tert-butyl 4-[5-fluoro-2-(2-oxo-2-pyrrolidin-1-ylethyl)phenyl]piperidine-1-carboxylate (PubChem CID 58222063) has the molecular formula C22H31FN2O3 and a molecular weight of 390.50 g/mol. Its IUPAC name is tert-butyl 4-[5-fluoro-2-(2-oxo-2-pyrrolidin-1-ylethyl)phenyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[5-fluoro-2-(2-oxo-2-pyrrolidin-1-ylethyl)phenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 58222063 |
| Molecular Formula | C22H31FN2O3 |
| Molecular Weight | 390.50 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | tert-butyl 4-[5-fluoro-2-(2-oxo-2-pyrrolidin-1-ylethyl)phenyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2cc(F)ccc2CC(=O)N2CCCC2)CC1 |
| InChI | InChI=1S/C22H31FN2O3/c1-22(2,3)28-21(27)25-12-8-16(9-13-25)19-15-18(23)7-6-17(19)14-20(26)24-10-4-5-11-24/h6-7,15-16H,4-5,8-14H2,1-3H3 |
| InChIKey | RHPKZXPUKPNCRF-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.50 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |