C20H31NO3 — CID 171109282
tert-butyl 4-(5-tert-butyl-2-hydroxyphenyl)piperidine-1-carboxylate (PubChem CID 171109282) has the molecular formula C20H31NO3 and a molecular weight of 333.47 g/mol. Its IUPAC name is tert-butyl 4-(5-tert-butyl-2-hydroxyphenyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(5-tert-butyl-2-hydroxyphenyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 171109282 |
| Molecular Formula | C20H31NO3 |
| Molecular Weight | 333.47 g/mol |
| Exact Mass | 333.23 |
| IUPAC Name | tert-butyl 4-(5-tert-butyl-2-hydroxyphenyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2cc(C(C)(C)C)ccc2O)CC1 |
| InChI | InChI=1S/C20H31NO3/c1-19(2,3)15-7-8-17(22)16(13-15)14-9-11-21(12-10-14)18(23)24-20(4,5)6/h7-8,13-14,22H,9-12H2,1-6H3 |
| InChIKey | ATCMGQUYDFECRM-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.47 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |