C22H25F2NO2S — CID 142946477
tert-butyl 4-[5-fluoro-2-(2-fluorophenyl)sulfanylphenyl]piperidine-1-carboxylate (PubChem CID 142946477) has the molecular formula C22H25F2NO2S and a molecular weight of 405.51 g/mol. Its IUPAC name is tert-butyl 4-[5-fluoro-2-(2-fluorophenyl)sulfanylphenyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[5-fluoro-2-(2-fluorophenyl)sulfanylphenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 142946477 |
| Molecular Formula | C22H25F2NO2S |
| Molecular Weight | 405.51 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | tert-butyl 4-[5-fluoro-2-(2-fluorophenyl)sulfanylphenyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2cc(F)ccc2Sc2ccccc2F)CC1 |
| InChI | InChI=1S/C22H25F2NO2S/c1-22(2,3)27-21(26)25-12-10-15(11-13-25)17-14-16(23)8-9-19(17)28-20-7-5-4-6-18(20)24/h4-9,14-15H,10-13H2,1-3H3 |
| InChIKey | BXGHUHZBVDVXMV-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.51 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |