C16H22FNO2S — CID 118159157
tert-butyl 4-(2-fluorophenyl)sulfanylpiperidine-1-carboxylate (PubChem CID 118159157) has the molecular formula C16H22FNO2S and a molecular weight of 311.42 g/mol. Its IUPAC name is tert-butyl 4-(2-fluorophenyl)sulfanylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(2-fluorophenyl)sulfanylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 118159157 |
| Molecular Formula | C16H22FNO2S |
| Molecular Weight | 311.42 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | tert-butyl 4-(2-fluorophenyl)sulfanylpiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Sc2ccccc2F)CC1 |
| InChI | InChI=1S/C16H22FNO2S/c1-16(2,3)20-15(19)18-10-8-12(9-11-18)21-14-7-5-4-6-13(14)17/h4-7,12H,8-11H2,1-3H3 |
| InChIKey | VXHXUKHJOXOSIX-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.42 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |