C17H24N2O4S — CID 162384028
tert-butyl 4-(2-methyl-4-nitrophenyl)sulfanylpiperidine-1-carboxylate (PubChem CID 162384028) has the molecular formula C17H24N2O4S and a molecular weight of 352.46 g/mol. Its IUPAC name is tert-butyl 4-(2-methyl-4-nitrophenyl)sulfanylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(2-methyl-4-nitrophenyl)sulfanylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 162384028 |
| Molecular Formula | C17H24N2O4S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | tert-butyl 4-(2-methyl-4-nitrophenyl)sulfanylpiperidine-1-carboxylate |
| SMILES | Cc1cc([N+](=O)[O-])ccc1SC1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C17H24N2O4S/c1-12-11-13(19(21)22)5-6-15(12)24-14-7-9-18(10-8-14)16(20)23-17(2,3)4/h5-6,11,14H,7-10H2,1-4H3 |
| InChIKey | RCBGOEWPYXUMHY-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|