C16H22N4O9S — CID 166060976
(2,4-dinitrophenyl)-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]sulfamic acid (PubChem CID 166060976) has the molecular formula C16H22N4O9S and a molecular weight of 446.44 g/mol. Its IUPAC name is (2,4-dinitrophenyl)-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]sulfamic acid.
| Compound Name | (2,4-dinitrophenyl)-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]sulfamic acid |
|---|---|
| PubChem CID | 166060976 |
| Molecular Formula | C16H22N4O9S |
| Molecular Weight | 446.44 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | (2,4-dinitrophenyl)-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]sulfamic acid |
| SMILES | CC(C)(C)OC(=O)N1CCC(N(c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])S(=O)(=O)O)CC1 |
| InChI | InChI=1S/C16H22N4O9S/c1-16(2,3)29-15(21)17-8-6-11(7-9-17)18(30(26,27)28)13-5-4-12(19(22)23)10-14(13)20(24)25/h4-5,10-11H,6-9H2,1-3H3,(H,26,27,28) |
| InChIKey | MWKXOFSGULQXTC-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 173.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.44 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|