C20H30BrN3O4 — CID 135157941
tert-butyl 4-[4-bromo-N-(2-methylpropyl)-2-nitroanilino]piperidine-1-carboxylate (PubChem CID 135157941) has the molecular formula C20H30BrN3O4 and a molecular weight of 456.38 g/mol. Its IUPAC name is tert-butyl 4-[4-bromo-N-(2-methylpropyl)-2-nitroanilino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-bromo-N-(2-methylpropyl)-2-nitroanilino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 135157941 |
| Molecular Formula | C20H30BrN3O4 |
| Molecular Weight | 456.38 g/mol |
| Exact Mass | 455.14 |
| IUPAC Name | tert-butyl 4-[4-bromo-N-(2-methylpropyl)-2-nitroanilino]piperidine-1-carboxylate |
| SMILES | CC(C)CN(c1ccc(Br)cc1[N+](=O)[O-])C1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C20H30BrN3O4/c1-14(2)13-23(17-7-6-15(21)12-18(17)24(26)27)16-8-10-22(11-9-16)19(25)28-20(3,4)5/h6-7,12,14,16H,8-11,13H2,1-5H3 |
| InChIKey | GNPSJKHPSUFNSL-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 75.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.38 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|