C22H33N3O5 — CID 146553061
methyl (3R)-3-[4-[(1-acetylpiperidin-4-yl)-(2-methylpropyl)amino]-3-nitrophenyl]butanoate (PubChem CID 146553061) has the molecular formula C22H33N3O5 and a molecular weight of 419.52 g/mol. Its IUPAC name is methyl (3R)-3-[4-[(1-acetylpiperidin-4-yl)-(2-methylpropyl)amino]-3-nitrophenyl]butanoate.
| Compound Name | methyl (3R)-3-[4-[(1-acetylpiperidin-4-yl)-(2-methylpropyl)amino]-3-nitrophenyl]butanoate |
|---|---|
| PubChem CID | 146553061 |
| Molecular Formula | C22H33N3O5 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.24 |
| IUPAC Name | methyl (3R)-3-[4-[(1-acetylpiperidin-4-yl)-(2-methylpropyl)amino]-3-nitrophenyl]butanoate |
| SMILES | COC(=O)C[C@@H](C)c1ccc(N(CC(C)C)C2CCN(C(C)=O)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H33N3O5/c1-15(2)14-24(19-8-10-23(11-9-19)17(4)26)20-7-6-18(13-21(20)25(28)29)16(3)12-22(27)30-5/h6-7,13,15-16,19H,8-12,14H2,1-5H3/t16-/m1/s1 |
| InChIKey | QVGMUHFCNCOQHU-MRXNPFEDSA-N |
| XLogP | 3.73 |
| TPSA | 92.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|