C23H35N3O6 — CID 142383605
methyl (3R)-3-[4-[[1-(2-methoxyacetyl)piperidin-4-yl]-(2-methylpropyl)amino]-3-nitrophenyl]butanoate (PubChem CID 142383605) has the molecular formula C23H35N3O6 and a molecular weight of 449.55 g/mol. Its IUPAC name is methyl (3R)-3-[4-[[1-(2-methoxyacetyl)piperidin-4-yl]-(2-methylpropyl)amino]-3-nitrophenyl]butanoate.
| Compound Name | methyl (3R)-3-[4-[[1-(2-methoxyacetyl)piperidin-4-yl]-(2-methylpropyl)amino]-3-nitrophenyl]butanoate |
|---|---|
| PubChem CID | 142383605 |
| Molecular Formula | C23H35N3O6 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.25 |
| IUPAC Name | methyl (3R)-3-[4-[[1-(2-methoxyacetyl)piperidin-4-yl]-(2-methylpropyl)amino]-3-nitrophenyl]butanoate |
| SMILES | COCC(=O)N1CCC(N(CC(C)C)c2ccc([C@H](C)CC(=O)OC)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C23H35N3O6/c1-16(2)14-25(19-8-10-24(11-9-19)22(27)15-31-4)20-7-6-18(13-21(20)26(29)30)17(3)12-23(28)32-5/h6-7,13,16-17,19H,8-12,14-15H2,1-5H3/t17-/m1/s1 |
| InChIKey | HQQGWCOKKSBPIF-QGZVFWFLSA-N |
| XLogP | 3.36 |
| TPSA | 102.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|