C25H40N2O4 — CID 142383558
ethyl 3-[4-[cyclohexyl(2-methylpropyl)amino]-3-[(2-methoxyacetyl)amino]phenyl]butanoate (PubChem CID 142383558) has the molecular formula C25H40N2O4 and a molecular weight of 432.61 g/mol. Its IUPAC name is ethyl 3-[4-[cyclohexyl(2-methylpropyl)amino]-3-[(2-methoxyacetyl)amino]phenyl]butanoate.
| Compound Name | ethyl 3-[4-[cyclohexyl(2-methylpropyl)amino]-3-[(2-methoxyacetyl)amino]phenyl]butanoate |
|---|---|
| PubChem CID | 142383558 |
| Molecular Formula | C25H40N2O4 |
| Molecular Weight | 432.61 g/mol |
| Exact Mass | 432.30 |
| IUPAC Name | ethyl 3-[4-[cyclohexyl(2-methylpropyl)amino]-3-[(2-methoxyacetyl)amino]phenyl]butanoate |
| SMILES | CCOC(=O)CC(C)c1ccc(N(CC(C)C)C2CCCCC2)c(NC(=O)COC)c1 |
| InChI | InChI=1S/C25H40N2O4/c1-6-31-25(29)14-19(4)20-12-13-23(22(15-20)26-24(28)17-30-5)27(16-18(2)3)21-10-8-7-9-11-21/h12-13,15,18-19,21H,6-11,14,16-17H2,1-5H3,(H,26,28) |
| InChIKey | WHAIIGKFTCTFTH-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.61 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |