C22H35N3O4 — CID 135172196
methyl 4-[2-amino-4-(4-methoxy-4-oxobutan-2-yl)-N-(2-methylpropyl)anilino]piperidine-1-carboxylate (PubChem CID 135172196) has the molecular formula C22H35N3O4 and a molecular weight of 405.54 g/mol. Its IUPAC name is methyl 4-[2-amino-4-(4-methoxy-4-oxobutan-2-yl)-N-(2-methylpropyl)anilino]piperidine-1-carboxylate.
| Compound Name | methyl 4-[2-amino-4-(4-methoxy-4-oxobutan-2-yl)-N-(2-methylpropyl)anilino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 135172196 |
| Molecular Formula | C22H35N3O4 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.26 |
| IUPAC Name | methyl 4-[2-amino-4-(4-methoxy-4-oxobutan-2-yl)-N-(2-methylpropyl)anilino]piperidine-1-carboxylate |
| SMILES | COC(=O)CC(C)c1ccc(N(CC(C)C)C2CCN(C(=O)OC)CC2)c(N)c1 |
| InChI | InChI=1S/C22H35N3O4/c1-15(2)14-25(18-8-10-24(11-9-18)22(27)29-5)20-7-6-17(13-19(20)23)16(3)12-21(26)28-4/h6-7,13,15-16,18H,8-12,14,23H2,1-5H3 |
| InChIKey | IDFOBICJRXDHSF-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 85.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|