C21H34N2O3 — CID 135153231
(3R)-3-[3-amino-4-[(4-methoxycyclohexyl)-(2-methylpropyl)amino]phenyl]butanoic acid (PubChem CID 135153231) has the molecular formula C21H34N2O3 and a molecular weight of 362.51 g/mol. Its IUPAC name is (3R)-3-[3-amino-4-[(4-methoxycyclohexyl)-(2-methylpropyl)amino]phenyl]butanoic acid.
| Compound Name | (3R)-3-[3-amino-4-[(4-methoxycyclohexyl)-(2-methylpropyl)amino]phenyl]butanoic acid |
|---|---|
| PubChem CID | 135153231 |
| Molecular Formula | C21H34N2O3 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.26 |
| IUPAC Name | (3R)-3-[3-amino-4-[(4-methoxycyclohexyl)-(2-methylpropyl)amino]phenyl]butanoic acid |
| SMILES | COC1CCC(N(CC(C)C)c2ccc([C@H](C)CC(=O)O)cc2N)CC1 |
| InChI | InChI=1S/C21H34N2O3/c1-14(2)13-23(17-6-8-18(26-4)9-7-17)20-10-5-16(12-19(20)22)15(3)11-21(24)25/h5,10,12,14-15,17-18H,6-9,11,13,22H2,1-4H3,(H,24,25)/t15-,17?,18?/m1/s1 |
| InChIKey | WPLXVHVGLLYHFS-FAEJEUNOSA-N |
| XLogP | 4.27 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|