C25H43N3O3 — CID 146552830
methyl (3R)-3-[3-amino-4-[[1-(1-hydroxy-3-methylbutyl)piperidin-4-yl]-(2-methylpropyl)amino]phenyl]butanoate (PubChem CID 146552830) has the molecular formula C25H43N3O3 and a molecular weight of 433.64 g/mol. Its IUPAC name is methyl (3R)-3-[3-amino-4-[[1-(1-hydroxy-3-methylbutyl)piperidin-4-yl]-(2-methylpropyl)amino]phenyl]butanoate.
| Compound Name | methyl (3R)-3-[3-amino-4-[[1-(1-hydroxy-3-methylbutyl)piperidin-4-yl]-(2-methylpropyl)amino]phenyl]butanoate |
|---|---|
| PubChem CID | 146552830 |
| Molecular Formula | C25H43N3O3 |
| Molecular Weight | 433.64 g/mol |
| Exact Mass | 433.33 |
| IUPAC Name | methyl (3R)-3-[3-amino-4-[[1-(1-hydroxy-3-methylbutyl)piperidin-4-yl]-(2-methylpropyl)amino]phenyl]butanoate |
| SMILES | COC(=O)C[C@@H](C)c1ccc(N(CC(C)C)C2CCN(C(O)CC(C)C)CC2)c(N)c1 |
| InChI | InChI=1S/C25H43N3O3/c1-17(2)13-24(29)27-11-9-21(10-12-27)28(16-18(3)4)23-8-7-20(15-22(23)26)19(5)14-25(30)31-6/h7-8,15,17-19,21,24,29H,9-14,16,26H2,1-6H3/t19-,24?/m1/s1 |
| InChIKey | GHWLJEMXLWAIEM-PHSANKKPSA-N |
| XLogP | 4.23 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.64 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|