C21H34N2O4 — CID 140744545
methyl (3R)-3-[3-amino-4-[ethyl(oxan-4-yl)amino]phenyl]-4-propan-2-yloxybutanoate (PubChem CID 140744545) has the molecular formula C21H34N2O4 and a molecular weight of 378.51 g/mol. Its IUPAC name is methyl (3R)-3-[3-amino-4-[ethyl(oxan-4-yl)amino]phenyl]-4-propan-2-yloxybutanoate.
| Compound Name | methyl (3R)-3-[3-amino-4-[ethyl(oxan-4-yl)amino]phenyl]-4-propan-2-yloxybutanoate |
|---|---|
| PubChem CID | 140744545 |
| Molecular Formula | C21H34N2O4 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.25 |
| IUPAC Name | methyl (3R)-3-[3-amino-4-[ethyl(oxan-4-yl)amino]phenyl]-4-propan-2-yloxybutanoate |
| SMILES | CCN(c1ccc([C@H](COC(C)C)CC(=O)OC)cc1N)C1CCOCC1 |
| InChI | InChI=1S/C21H34N2O4/c1-5-23(18-8-10-26-11-9-18)20-7-6-16(12-19(20)22)17(13-21(24)25-4)14-27-15(2)3/h6-7,12,15,17-18H,5,8-11,13-14,22H2,1-4H3/t17-/m0/s1 |
| InChIKey | TUTQGXKELAGDSF-KRWDZBQOSA-N |
| XLogP | 3.35 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|