C20H32N2O3 — CID 122587355
methyl 3-[3-amino-4-[oxan-4-yl(propyl)amino]phenyl]pentanoate (PubChem CID 122587355) has the molecular formula C20H32N2O3 and a molecular weight of 348.49 g/mol. Its IUPAC name is methyl 3-[3-amino-4-[oxan-4-yl(propyl)amino]phenyl]pentanoate.
| Compound Name | methyl 3-[3-amino-4-[oxan-4-yl(propyl)amino]phenyl]pentanoate |
|---|---|
| PubChem CID | 122587355 |
| Molecular Formula | C20H32N2O3 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.24 |
| IUPAC Name | methyl 3-[3-amino-4-[oxan-4-yl(propyl)amino]phenyl]pentanoate |
| SMILES | CCCN(c1ccc(C(CC)CC(=O)OC)cc1N)C1CCOCC1 |
| InChI | InChI=1S/C20H32N2O3/c1-4-10-22(17-8-11-25-12-9-17)19-7-6-16(13-18(19)21)15(5-2)14-20(23)24-3/h6-7,13,15,17H,4-5,8-12,14,21H2,1-3H3 |
| InChIKey | DVGVVJIILAHYRW-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|