C19H30N2O4 — CID 122587029
(3S)-3-[3-amino-4-[oxan-4-yl(propyl)amino]phenyl]-4-methoxybutanoic acid (PubChem CID 122587029) has the molecular formula C19H30N2O4 and a molecular weight of 350.46 g/mol. Its IUPAC name is (3S)-3-[3-amino-4-[oxan-4-yl(propyl)amino]phenyl]-4-methoxybutanoic acid.
| Compound Name | (3S)-3-[3-amino-4-[oxan-4-yl(propyl)amino]phenyl]-4-methoxybutanoic acid |
|---|---|
| PubChem CID | 122587029 |
| Molecular Formula | C19H30N2O4 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | (3S)-3-[3-amino-4-[oxan-4-yl(propyl)amino]phenyl]-4-methoxybutanoic acid |
| SMILES | CCCN(c1ccc([C@@H](COC)CC(=O)O)cc1N)C1CCOCC1 |
| InChI | InChI=1S/C19H30N2O4/c1-3-8-21(16-6-9-25-10-7-16)18-5-4-14(11-17(18)20)15(13-24-2)12-19(22)23/h4-5,11,15-16H,3,6-10,12-13,20H2,1-2H3,(H,22,23)/t15-/m1/s1 |
| InChIKey | VHEOVWUFXRJJKG-OAHLLOKOSA-N |
| XLogP | 2.87 |
| TPSA | 85.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|