C25H33ClN2O5 — CID 122586351
3-[3-(4-chloroanilino)-4-[2-methoxyethyl(oxan-4-yl)amino]phenyl]-4-methoxybutanoic acid (PubChem CID 122586351) has the molecular formula C25H33ClN2O5 and a molecular weight of 477.00 g/mol. Its IUPAC name is 3-[3-(4-chloroanilino)-4-[2-methoxyethyl(oxan-4-yl)amino]phenyl]-4-methoxybutanoic acid.
| Compound Name | 3-[3-(4-chloroanilino)-4-[2-methoxyethyl(oxan-4-yl)amino]phenyl]-4-methoxybutanoic acid |
|---|---|
| PubChem CID | 122586351 |
| Molecular Formula | C25H33ClN2O5 |
| Molecular Weight | 477.00 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | 3-[3-(4-chloroanilino)-4-[2-methoxyethyl(oxan-4-yl)amino]phenyl]-4-methoxybutanoic acid |
| SMILES | COCCN(c1ccc(C(COC)CC(=O)O)cc1Nc1ccc(Cl)cc1)C1CCOCC1 |
| InChI | InChI=1S/C25H33ClN2O5/c1-31-14-11-28(22-9-12-33-13-10-22)24-8-3-18(19(17-32-2)16-25(29)30)15-23(24)27-21-6-4-20(26)5-7-21/h3-8,15,19,22,27H,9-14,16-17H2,1-2H3,(H,29,30) |
| InChIKey | GNSYBYLJLWKJPT-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 80.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.00 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |