C26H33N3O4 — CID 122587203
3-[3-(4-cyano-2-methylanilino)-4-[ethyl(oxan-4-yl)amino]phenyl]-4-methoxybutanoic acid (PubChem CID 122587203) has the molecular formula C26H33N3O4 and a molecular weight of 451.57 g/mol. Its IUPAC name is 3-[3-(4-cyano-2-methylanilino)-4-[ethyl(oxan-4-yl)amino]phenyl]-4-methoxybutanoic acid.
| Compound Name | 3-[3-(4-cyano-2-methylanilino)-4-[ethyl(oxan-4-yl)amino]phenyl]-4-methoxybutanoic acid |
|---|---|
| PubChem CID | 122587203 |
| Molecular Formula | C26H33N3O4 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.25 |
| IUPAC Name | 3-[3-(4-cyano-2-methylanilino)-4-[ethyl(oxan-4-yl)amino]phenyl]-4-methoxybutanoic acid |
| SMILES | CCN(c1ccc(C(COC)CC(=O)O)cc1Nc1ccc(C#N)cc1C)C1CCOCC1 |
| InChI | InChI=1S/C26H33N3O4/c1-4-29(22-9-11-33-12-10-22)25-8-6-20(21(17-32-3)15-26(30)31)14-24(25)28-23-7-5-19(16-27)13-18(23)2/h5-8,13-14,21-22,28H,4,9-12,15,17H2,1-3H3,(H,30,31) |
| InChIKey | LPUIMGKVHFGOTO-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |