C26H32N4O4 — CID 145166094
1-(4-cyanophenyl)-3-[2-[ethyl(oxan-4-yl)amino]-5-(1-methoxy-4-oxobutan-2-yl)phenyl]urea (PubChem CID 145166094) has the molecular formula C26H32N4O4 and a molecular weight of 464.57 g/mol. Its IUPAC name is 1-(4-cyanophenyl)-3-[2-[ethyl(oxan-4-yl)amino]-5-(1-methoxy-4-oxobutan-2-yl)phenyl]urea.
| Compound Name | 1-(4-cyanophenyl)-3-[2-[ethyl(oxan-4-yl)amino]-5-(1-methoxy-4-oxobutan-2-yl)phenyl]urea |
|---|---|
| PubChem CID | 145166094 |
| Molecular Formula | C26H32N4O4 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.24 |
| IUPAC Name | 1-(4-cyanophenyl)-3-[2-[ethyl(oxan-4-yl)amino]-5-(1-methoxy-4-oxobutan-2-yl)phenyl]urea |
| SMILES | CCN(c1ccc(C(CC=O)COC)cc1NC(=O)Nc1ccc(C#N)cc1)C1CCOCC1 |
| InChI | InChI=1S/C26H32N4O4/c1-3-30(23-11-14-34-15-12-23)25-9-6-20(21(10-13-31)18-33-2)16-24(25)29-26(32)28-22-7-4-19(17-27)5-8-22/h4-9,13,16,21,23H,3,10-12,14-15,18H2,1-2H3,(H2,28,29,32) |
| InChIKey | GLXNPOVUCIFRRQ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 103.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|