C24H29ClFN3O4 — CID 145165950
1-(4-chloro-2-fluorophenyl)-3-[5-(1-methoxy-4-oxobutan-2-yl)-2-[methyl(oxan-4-yl)amino]phenyl]urea (PubChem CID 145165950) has the molecular formula C24H29ClFN3O4 and a molecular weight of 477.96 g/mol. Its IUPAC name is 1-(4-chloro-2-fluorophenyl)-3-[5-(1-methoxy-4-oxobutan-2-yl)-2-[methyl(oxan-4-yl)amino]phenyl]urea.
| Compound Name | 1-(4-chloro-2-fluorophenyl)-3-[5-(1-methoxy-4-oxobutan-2-yl)-2-[methyl(oxan-4-yl)amino]phenyl]urea |
|---|---|
| PubChem CID | 145165950 |
| Molecular Formula | C24H29ClFN3O4 |
| Molecular Weight | 477.96 g/mol |
| Exact Mass | 477.18 |
| IUPAC Name | 1-(4-chloro-2-fluorophenyl)-3-[5-(1-methoxy-4-oxobutan-2-yl)-2-[methyl(oxan-4-yl)amino]phenyl]urea |
| SMILES | COCC(CC=O)c1ccc(N(C)C2CCOCC2)c(NC(=O)Nc2ccc(Cl)cc2F)c1 |
| InChI | InChI=1S/C24H29ClFN3O4/c1-29(19-8-11-33-12-9-19)23-6-3-16(17(7-10-30)15-32-2)13-22(23)28-24(31)27-21-5-4-18(25)14-20(21)26/h3-6,10,13-14,17,19H,7-9,11-12,15H2,1-2H3,(H2,27,28,31) |
| InChIKey | OTPXUWDJQAQBLQ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.96 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|