C25H34N2O4 — CID 122586670
3-[4-[ethyl(oxan-4-yl)amino]-3-(4-methylanilino)phenyl]-4-methoxybutanoic acid (PubChem CID 122586670) has the molecular formula C25H34N2O4 and a molecular weight of 426.56 g/mol. Its IUPAC name is 3-[4-[ethyl(oxan-4-yl)amino]-3-(4-methylanilino)phenyl]-4-methoxybutanoic acid.
| Compound Name | 3-[4-[ethyl(oxan-4-yl)amino]-3-(4-methylanilino)phenyl]-4-methoxybutanoic acid |
|---|---|
| PubChem CID | 122586670 |
| Molecular Formula | C25H34N2O4 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.25 |
| IUPAC Name | 3-[4-[ethyl(oxan-4-yl)amino]-3-(4-methylanilino)phenyl]-4-methoxybutanoic acid |
| SMILES | CCN(c1ccc(C(COC)CC(=O)O)cc1Nc1ccc(C)cc1)C1CCOCC1 |
| InChI | InChI=1S/C25H34N2O4/c1-4-27(22-11-13-31-14-12-22)24-10-7-19(20(17-30-3)16-25(28)29)15-23(24)26-21-8-5-18(2)6-9-21/h5-10,15,20,22,26H,4,11-14,16-17H2,1-3H3,(H,28,29) |
| InChIKey | UTPZERBSTWZUQW-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |