C26H36N2O5S — CID 122586750
(3R)-3-[4-[ethyl(oxan-4-yl)amino]-3-(4-ethylsulfonylanilino)phenyl]pentanoic acid (PubChem CID 122586750) has the molecular formula C26H36N2O5S and a molecular weight of 488.65 g/mol. Its IUPAC name is (3R)-3-[4-[ethyl(oxan-4-yl)amino]-3-(4-ethylsulfonylanilino)phenyl]pentanoic acid.
| Compound Name | (3R)-3-[4-[ethyl(oxan-4-yl)amino]-3-(4-ethylsulfonylanilino)phenyl]pentanoic acid |
|---|---|
| PubChem CID | 122586750 |
| Molecular Formula | C26H36N2O5S |
| Molecular Weight | 488.65 g/mol |
| Exact Mass | 488.23 |
| IUPAC Name | (3R)-3-[4-[ethyl(oxan-4-yl)amino]-3-(4-ethylsulfonylanilino)phenyl]pentanoic acid |
| SMILES | CC[C@H](CC(=O)O)c1ccc(N(CC)C2CCOCC2)c(Nc2ccc(S(=O)(=O)CC)cc2)c1 |
| InChI | InChI=1S/C26H36N2O5S/c1-4-19(18-26(29)30)20-7-12-25(28(5-2)22-13-15-33-16-14-22)24(17-20)27-21-8-10-23(11-9-21)34(31,32)6-3/h7-12,17,19,22,27H,4-6,13-16,18H2,1-3H3,(H,29,30)/t19-/m1/s1 |
| InChIKey | LLXFSGBUJPHXIM-LJQANCHMSA-N |
| XLogP | 5.20 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.65 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |