C25H35N3O4 — CID 122587252
(3S)-3-[3-[(6-methoxy-3-pyridinyl)amino]-4-[oxan-4-yl(propyl)amino]phenyl]pentanoic acid (PubChem CID 122587252) has the molecular formula C25H35N3O4 and a molecular weight of 441.57 g/mol. Its IUPAC name is (3S)-3-[3-[(6-methoxy-3-pyridinyl)amino]-4-[oxan-4-yl(propyl)amino]phenyl]pentanoic acid.
| Compound Name | (3S)-3-[3-[(6-methoxy-3-pyridinyl)amino]-4-[oxan-4-yl(propyl)amino]phenyl]pentanoic acid |
|---|---|
| PubChem CID | 122587252 |
| Molecular Formula | C25H35N3O4 |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 441.26 |
| IUPAC Name | (3S)-3-[3-[(6-methoxy-3-pyridinyl)amino]-4-[oxan-4-yl(propyl)amino]phenyl]pentanoic acid |
| SMILES | CCCN(c1ccc([C@@H](CC)CC(=O)O)cc1Nc1ccc(OC)nc1)C1CCOCC1 |
| InChI | InChI=1S/C25H35N3O4/c1-4-12-28(21-10-13-32-14-11-21)23-8-6-19(18(5-2)16-25(29)30)15-22(23)27-20-7-9-24(31-3)26-17-20/h6-9,15,17-18,21,27H,4-5,10-14,16H2,1-3H3,(H,29,30)/t18-/m0/s1 |
| InChIKey | GETSIKHZFFLVQF-SFHVURJKSA-N |
| XLogP | 5.20 |
| TPSA | 83.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |