C27H37N3O5 — CID 122589826
(3S)-3-[3-[(4-ethoxyphenyl)carbamoylamino]-4-[ethyl(oxan-4-yl)amino]phenyl]pentanoic acid (PubChem CID 122589826) has the molecular formula C27H37N3O5 and a molecular weight of 483.61 g/mol. Its IUPAC name is (3S)-3-[3-[(4-ethoxyphenyl)carbamoylamino]-4-[ethyl(oxan-4-yl)amino]phenyl]pentanoic acid.
| Compound Name | (3S)-3-[3-[(4-ethoxyphenyl)carbamoylamino]-4-[ethyl(oxan-4-yl)amino]phenyl]pentanoic acid |
|---|---|
| PubChem CID | 122589826 |
| Molecular Formula | C27H37N3O5 |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.27 |
| IUPAC Name | (3S)-3-[3-[(4-ethoxyphenyl)carbamoylamino]-4-[ethyl(oxan-4-yl)amino]phenyl]pentanoic acid |
| SMILES | CCOc1ccc(NC(=O)Nc2cc([C@@H](CC)CC(=O)O)ccc2N(CC)C2CCOCC2)cc1 |
| InChI | InChI=1S/C27H37N3O5/c1-4-19(18-26(31)32)20-7-12-25(30(5-2)22-13-15-34-16-14-22)24(17-20)29-27(33)28-21-8-10-23(11-9-21)35-6-3/h7-12,17,19,22H,4-6,13-16,18H2,1-3H3,(H,31,32)(H2,28,29,33)/t19-/m0/s1 |
| InChIKey | SNJUKXRFODCMGJ-IBGZPJMESA-N |
| XLogP | 5.70 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |