C29H42N2O3 — CID 122586992
3-[4-[cyclohexyl(2-methylpropyl)amino]-3-(4-ethoxyanilino)phenyl]pentanoic acid (PubChem CID 122586992) has the molecular formula C29H42N2O3 and a molecular weight of 466.67 g/mol. Its IUPAC name is 3-[4-[cyclohexyl(2-methylpropyl)amino]-3-(4-ethoxyanilino)phenyl]pentanoic acid.
| Compound Name | 3-[4-[cyclohexyl(2-methylpropyl)amino]-3-(4-ethoxyanilino)phenyl]pentanoic acid |
|---|---|
| PubChem CID | 122586992 |
| Molecular Formula | C29H42N2O3 |
| Molecular Weight | 466.67 g/mol |
| Exact Mass | 466.32 |
| IUPAC Name | 3-[4-[cyclohexyl(2-methylpropyl)amino]-3-(4-ethoxyanilino)phenyl]pentanoic acid |
| SMILES | CCOc1ccc(Nc2cc(C(CC)CC(=O)O)ccc2N(CC(C)C)C2CCCCC2)cc1 |
| InChI | InChI=1S/C29H42N2O3/c1-5-22(19-29(32)33)23-12-17-28(31(20-21(3)4)25-10-8-7-9-11-25)27(18-23)30-24-13-15-26(16-14-24)34-6-2/h12-18,21-22,25,30H,5-11,19-20H2,1-4H3,(H,32,33) |
| InChIKey | UUUGLTZVVKFACC-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.67 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |