C25H36N4O3 — CID 122586945
3-[4-[cyclohexyl(ethyl)amino]-3-[(2-ethoxypyrimidin-5-yl)amino]phenyl]pentanoic acid (PubChem CID 122586945) has the molecular formula C25H36N4O3 and a molecular weight of 440.59 g/mol. Its IUPAC name is 3-[4-[cyclohexyl(ethyl)amino]-3-[(2-ethoxypyrimidin-5-yl)amino]phenyl]pentanoic acid.
| Compound Name | 3-[4-[cyclohexyl(ethyl)amino]-3-[(2-ethoxypyrimidin-5-yl)amino]phenyl]pentanoic acid |
|---|---|
| PubChem CID | 122586945 |
| Molecular Formula | C25H36N4O3 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.28 |
| IUPAC Name | 3-[4-[cyclohexyl(ethyl)amino]-3-[(2-ethoxypyrimidin-5-yl)amino]phenyl]pentanoic acid |
| SMILES | CCOc1ncc(Nc2cc(C(CC)CC(=O)O)ccc2N(CC)C2CCCCC2)cn1 |
| InChI | InChI=1S/C25H36N4O3/c1-4-18(15-24(30)31)19-12-13-23(29(5-2)21-10-8-7-9-11-21)22(14-19)28-20-16-26-25(27-17-20)32-6-3/h12-14,16-18,21,28H,4-11,15H2,1-3H3,(H,30,31) |
| InChIKey | ICVJFJRAJAFCHJ-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 87.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |