C25H35N3O4 — CID 146422315
3-[3-[(2-ethoxypyrimidin-5-yl)amino]-4-[(1S)-1-(oxan-4-yl)propyl]phenyl]pentanoic acid (PubChem CID 146422315) has the molecular formula C25H35N3O4 and a molecular weight of 441.57 g/mol. Its IUPAC name is 3-[3-[(2-ethoxypyrimidin-5-yl)amino]-4-[(1S)-1-(oxan-4-yl)propyl]phenyl]pentanoic acid.
| Compound Name | 3-[3-[(2-ethoxypyrimidin-5-yl)amino]-4-[(1S)-1-(oxan-4-yl)propyl]phenyl]pentanoic acid |
|---|---|
| PubChem CID | 146422315 |
| Molecular Formula | C25H35N3O4 |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 441.26 |
| IUPAC Name | 3-[3-[(2-ethoxypyrimidin-5-yl)amino]-4-[(1S)-1-(oxan-4-yl)propyl]phenyl]pentanoic acid |
| SMILES | CCOc1ncc(Nc2cc(C(CC)CC(=O)O)ccc2[C@@H](CC)C2CCOCC2)cn1 |
| InChI | InChI=1S/C25H35N3O4/c1-4-17(14-24(29)30)19-7-8-22(21(5-2)18-9-11-31-12-10-18)23(13-19)28-20-15-26-25(27-16-20)32-6-3/h7-8,13,15-18,21,28H,4-6,9-12,14H2,1-3H3,(H,29,30)/t17?,21-/m0/s1 |
| InChIKey | LLPBFCSEVCUGMN-LFABVHOISA-N |
| XLogP | 5.51 |
| TPSA | 93.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |