C27H37FN2O2 — CID 122588042
3-[5-anilino-4-[cyclohexyl(2-methylpropyl)amino]-2-fluorophenyl]pentanoic acid (PubChem CID 122588042) has the molecular formula C27H37FN2O2 and a molecular weight of 440.60 g/mol. Its IUPAC name is 3-[5-anilino-4-[cyclohexyl(2-methylpropyl)amino]-2-fluorophenyl]pentanoic acid.
| Compound Name | 3-[5-anilino-4-[cyclohexyl(2-methylpropyl)amino]-2-fluorophenyl]pentanoic acid |
|---|---|
| PubChem CID | 122588042 |
| Molecular Formula | C27H37FN2O2 |
| Molecular Weight | 440.60 g/mol |
| Exact Mass | 440.28 |
| IUPAC Name | 3-[5-anilino-4-[cyclohexyl(2-methylpropyl)amino]-2-fluorophenyl]pentanoic acid |
| SMILES | CCC(CC(=O)O)c1cc(Nc2ccccc2)c(N(CC(C)C)C2CCCCC2)cc1F |
| InChI | InChI=1S/C27H37FN2O2/c1-4-20(15-27(31)32)23-16-25(29-21-11-7-5-8-12-21)26(17-24(23)28)30(18-19(2)3)22-13-9-6-10-14-22/h5,7-8,11-12,16-17,19-20,22,29H,4,6,9-10,13-15,18H2,1-3H3,(H,31,32) |
| InChIKey | GMPRNLZWNRMXJL-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.60 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |